| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:48 UTC |
|---|
| Update Date | 2025-03-25 00:50:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182625 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H32O15 |
|---|
| Molecular Mass | 536.1741 |
|---|
| SMILES | O=CC(O)C(O)C(OC1OC(CO)C(O)C(OC(=O)CC(O)Cc2ccc(O)c(O)c2)C1O)C(O)CO |
|---|
| InChI Key | BLLBZQJJCJALKW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | saccharolipids |
|---|
| Subclass | saccharolipids |
|---|
| Direct Parent | saccharolipids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalkyl glycosidesalpha-hydroxyaldehydesbenzene and substituted derivativesbeta hydroxy acids and derivativesbeta-hydroxy aldehydescarboxylic acid estersfatty acid estersfatty acyl glycosides of mono- and disaccharidesfatty alcoholshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidemonocyclic benzene moietybeta-hydroxy aldehydecarbonyl grouparomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativebeta-hydroxy acidsaccharideorganic oxidealpha-hydroxyaldehydeacetalfatty alcoholoxaneprimary alcoholorganoheterocyclic compoundalcoholfatty acyl glycosidealdehydehydroxy acid1-hydroxy-4-unsubstituted benzenoidoxacyclefatty acid estermonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholphenolhydrocarbon derivativebenzenoidsaccharolipidorganooxygen compoundalkyl glycoside |
|---|
