| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:49 UTC |
|---|
| Update Date | 2025-03-25 00:50:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182645 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18O12 |
|---|
| Molecular Mass | 366.0798 |
|---|
| SMILES | O=CC(O)C(O)C(OC1C=C(C(=O)O)CC(O)(C(=O)O)O1)C(O)CO |
|---|
| InChI Key | ONAZZFIRUGEXAO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalpha hydroxy acids and derivativesalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acidsdicarboxylic acids and derivativesfatty alcoholshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | fatty acylbeta-hydroxy aldehydecarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidecarboxylic acid derivativesaccharideorganic oxidealpha-hydroxyaldehydeacetalfatty alcoholaliphatic heteromonocyclic compoundhemiacetalprimary alcoholalcoholpyran carboxylic acid or derivativesaldehydehydroxy acidoxacycleorganic oxygen compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|