| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:52 UTC |
|---|
| Update Date | 2025-03-25 00:50:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182756 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14O9 |
|---|
| Molecular Mass | 266.0638 |
|---|
| SMILES | O=CC(O)C(OC1OCC(O)C(O)C1O)C(=O)O |
|---|
| InChI Key | CHYSEPUZGGFCMW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | heterocyclic fatty acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalpha-hydroxyaldehydesbeta hydroxy acids and derivativescarboxylic acidshydrocarbon derivativeshydroxy fatty acidsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcoholsshort-chain hydroxy acids and derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acidshort-chain hydroxy acidheterocyclic fatty acidmonosaccharidecarboxylic acid derivativebeta-hydroxy acidsaccharideorganic oxidealpha-hydroxyaldehydeacetalaliphatic heteromonocyclic compoundhydroxy fatty acidoxaneorganoheterocyclic compoundalcoholaldehydehydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
