| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:52 UTC |
|---|
| Update Date | 2025-03-25 00:50:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182787 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H9ClO4 |
|---|
| Molecular Mass | 288.0189 |
|---|
| SMILES | O=c1c(-c2ccc(O)cc2)coc2ccc(O)c(Cl)c12 |
|---|
| InChI Key | MFVRQKDRZSUVEH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl chloridesbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsorganic oxidesorganochloridesorganooxygen compoundsoxacyclic compoundspyranones and derivativesvinylogous halides |
|---|
| Substituents | monocyclic benzene moiety1-benzopyranorganochloride1-hydroxy-2-unsubstituted benzenoidorganohalogen compoundorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundaryl chlorideisoflavonebenzopyranheteroaromatic compoundvinylogous halidearyl halideoxacycleorganic oxygen compoundpyranphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
