| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:53 UTC |
|---|
| Update Date | 2025-03-25 00:50:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182822 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O5 |
|---|
| Molecular Mass | 270.0528 |
|---|
| SMILES | O=c1c(O)c(Oc2ccc(O)cc2)oc2ccccc12 |
|---|
| InChI Key | GIGLIFLJSRADTK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarins and derivatives |
|---|
| Direct Parent | coumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidschromonesdiarylethersheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundsphenol ethersphenoxy compoundspyranones and derivativesvinylogous esters |
|---|
| Substituents | diaryl etherphenol ethermonocyclic benzene moietyetherbenzopyran1-benzopyranvinylogous esterheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidcoumarinoxacycleorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyranpyranonephenolhydrocarbon derivativebenzenoidphenoxy compoundorganoheterocyclic compoundorganooxygen compound |
|---|
