| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:54 UTC |
|---|
| Update Date | 2025-03-25 00:50:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182848 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H11N3O10S |
|---|
| Molecular Mass | 341.0165 |
|---|
| SMILES | O=c1nc(OS(=O)(=O)O)[nH]c(=O)n1C1OC(CO)C(O)C1O |
|---|
| InChI Key | WPVJMVFXTSRGNM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundshalo-s-triazinesheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholssulfuric acid monoesterstetrahydrofuranstriazinones |
|---|
| Substituents | sulfuric acid monoesteraromatic heteromonocyclic compoundmonosaccharidesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundarylsulfateprimary alcoholorganoheterocyclic compoundalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundhalo-s-triazinesecondary alcoholtriazinesulfate-esterhydrocarbon derivative1,3,5-triazineorganic nitrogen compoundsulfuric acid estertriazinoneorganooxygen compound |
|---|
