| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 14:51:55 UTC |
|---|
| Update Date | 2025-03-25 00:50:45 UTC |
|---|
| HMDB ID | HMDB0245543 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182898 |
|---|
| Name | 2',3'-Dideoxy-3'-fluorouridine |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11FN2O4 |
|---|
| Molecular Mass | 230.0703 |
|---|
| SMILES | O=c1ccn(C2CC(F)C(CO)O2)c(=O)[nH]1 |
|---|
| InChI Key | BKIUEHLYJFLWPK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | lactamaromatic heteromonocyclic compoundpyrimidoneorganohalogen compoundorganic oxideorganonitrogen compoundorganopnictogen compoundalkyl halideprimary alcoholalcoholvinylogous amidecarbonic acid derivativeazacycletetrahydrofuranalkyl fluorideorganofluorideheteroaromatic compoundoxacycleorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
