| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:56 UTC |
|---|
| Update Date | 2025-03-25 00:50:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182914 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O3 |
|---|
| Molecular Mass | 238.063 |
|---|
| SMILES | O=c1ccoc2cc(-c3ccccc3)c(O)cc12 |
|---|
| InChI Key | WKEKASFYPUDORD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzopyrans |
|---|
| Subclass | 1-benzopyrans |
|---|
| Direct Parent | chromones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | monocyclic benzene moietyheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidoxacycleorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyranpyranonehydrocarbon derivativebenzenoidorganooxygen compound |
|---|
