| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:56 UTC |
|---|
| Update Date | 2025-03-25 00:50:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182933 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H14O7 |
|---|
| Molecular Mass | 414.074 |
|---|
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2cc3occ(-c4ccc(O)cc4)c(=O)c3c(O)c12 |
|---|
| InChI Key | ITUFMYIEMBDMQI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | pyranoflavonoids |
|---|
| Direct Parent | pyranoflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids5-hydroxyflavonoidsbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonesisoflavonoidsorganic oxidesorganooxygen compoundsoxacyclic compoundspyranochromenespyranones and derivativesvinylogous acids |
|---|
| Substituents | monocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidorganic oxidepyranoflavonoidchromonearomatic heteropolycyclic compoundisoflavonoidpyranoneorganoheterocyclic compoundisoflavonebenzopyranpyranochromeneheteroaromatic compound5-hydroxyflavonoidisoflavonoid skeleton1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundpyran4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
