| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:56 UTC |
|---|
| Update Date | 2025-03-25 00:50:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182937 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H15ClN4O5 |
|---|
| Molecular Mass | 378.0731 |
|---|
| SMILES | O=c1c2ncn(C3OC(CO)C(O)C3O)c2ncn1-c1ccc(Cl)cc1 |
|---|
| InChI Key | ASLGSBTZCDJSFG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundschlorobenzenesheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspurines and purine derivativespyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | monocyclic benzene moietylactamorganochloridemonosaccharidepyrimidoneimidazopyrimidineorganohalogen compoundpyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolearyl chloridechlorobenzenealcoholvinylogous amideazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundaryl halideoxacycleorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativebenzenoidpurineorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
