| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:57 UTC |
|---|
| Update Date | 2025-03-25 00:50:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182943 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H11NO2 |
|---|
| Molecular Mass | 261.079 |
|---|
| SMILES | O=c1c2ccccc2[nH]c2c1ccc1cc(O)ccc12 |
|---|
| InChI Key | XYIMNVBGSALXLO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | benzoquinolines |
|---|
| Direct Parent | benzacridines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2-halopyridinesacridonesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroquinolineshydroquinoloneshydroxypyridinesnaphthols and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinesvinylogous amides |
|---|
| Substituents | polyhalopyridine1-hydroxy-2-unsubstituted benzenoidbenz-c-acridineacridoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound2-halopyridine2-naphtholvinylogous amideazacycleheteroaromatic compoundhydroxypyridinedihydroquinolinedihydroquinolonepyridinenaphthaleneorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|