| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:51:57 UTC |
|---|
| Update Date | 2025-03-25 00:50:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02182963 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H8O7S |
|---|
| Molecular Mass | 283.9991 |
|---|
| SMILES | O=c1cc(O)cc(-c2ccc(OS(=O)(=O)O)cc2)o1 |
|---|
| InChI Key | ODCIXMJXHKQQNI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | heteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundsphenoxy compoundspyranones and derivativessulfuric acid monoestersvinylogous acids |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoesteraromatic heteromonocyclic compoundheteroaromatic compoundlactonephenylsulfateoxacyclevinylogous acidorganic oxideorganic oxygen compoundpyranpyranonesulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganoheterocyclic compoundorganooxygen compound |
|---|