| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:00 UTC |
|---|
| Update Date | 2025-03-25 00:50:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183067 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12NO8+ |
|---|
| Molecular Mass | 226.0557 |
|---|
| SMILES | O=[N+](O)OC1C(CO)OC(O)C(O)C1O |
|---|
| InChI Key | NGDIKCOKYNUGGC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl nitrateshemiacetalshydrocarbon derivativesorganic cationsorganic nitric acids and derivativesorganic nitro compoundsorganic nitrogen compoundsorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholorganic nitric acid or derivativesorganic nitratemonosaccharideorganic nitro compoundoxacycleorganic oxidealkyl nitratealiphatic heteromonocyclic compoundsecondary alcoholhemiacetalhydrocarbon derivativeorganic nitrogen compoundorganic cationoxaneprimary alcoholorganoheterocyclic compound |
|---|
