| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:02 UTC |
|---|
| Update Date | 2025-03-25 00:50:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183112 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H17N5O13P2 |
|---|
| Molecular Mass | 525.0298 |
|---|
| SMILES | O=c1nc2n(CC(O)C(O)C(O)COP(=O)(O)OP(=O)(O)O)c3nc(O)ccc3nc-2c(=O)[nH]1 |
|---|
| InChI Key | RZNWDMJTOOYPIK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyridineslactamsmonoalkyl phosphatesorganic carbonic acids and derivativesorganic oxidesorganic pyrophosphatesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinespyrazinespyridopyrazinespyrimidonessecondary alcohols |
|---|
| Substituents | pyridopyrazinelactampolyhalopyridinepyrimidonepteridinepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound2-halopyridinealcoholcarbonic acid derivativeazacycleheteroaromatic compoundhydroxypyridineorganic pyrophosphatepyridineorganic oxygen compoundphosphoric acid estermonoalkyl phosphatepyrazinesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|