| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:03 UTC |
|---|
| Update Date | 2025-03-25 00:50:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183160 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO4S |
|---|
| Molecular Mass | 305.0722 |
|---|
| SMILES | O=S(O)c1cccc2c1CC(O)C(c1ccc(O)cc1)N2 |
|---|
| InChI Key | UFUYLJKRFQIGCQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | phenylquinolines |
|---|
| Direct Parent | phenylquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativeshydrocarbon derivativeshydroquinolinesorganic oxidesorganopnictogen compoundsorganosulfur compoundssecondary alcoholssecondary alkylarylaminessulfinic acids |
|---|
| Substituents | monocyclic benzene moietyphenylquinolinesulfinic acid derivative1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundsulfinic acidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundtetrahydroquinolinealcoholazacyclesecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|