| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:03 UTC |
|---|
| Update Date | 2025-03-25 00:50:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183164 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O6S2 |
|---|
| Molecular Mass | 354.0232 |
|---|
| SMILES | O=S(O)c1cc2c(c(S(=O)O)c1)CC(O)C(c1ccccc1)O2 |
|---|
| InChI Key | KYZAWMFFEVRXOD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 3-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransalkyl aryl ethersbenzene and substituted derivativesflavan-3-olshydrocarbon derivativesorganic oxidesorganosulfur compoundsoxacyclic compoundssecondary alcoholssulfinic acids |
|---|
| Substituents | alcoholmonocyclic benzene moiety3-hydroxyflavonoidetherbenzopyran1-benzopyranflavansulfinic acid derivativealkyl aryl etherorganosulfur compoundsulfinic acidoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundsecondary alcoholchromanehydrocarbon derivativebenzenoidflavan-3-olorganoheterocyclic compoundorganooxygen compound |
|---|
