| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:04 UTC |
|---|
| Update Date | 2025-03-25 00:50:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183206 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H14O3 |
|---|
| Molecular Mass | 302.0943 |
|---|
| SMILES | O=C(Oc1ccccc1)c1ccccc1C(=O)c1ccccc1 |
|---|
| InChI Key | QERSPBWYFVWQLY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | depsides and depsidones |
|---|
| Subclass | depsides and depsidones |
|---|
| Direct Parent | depsides and depsidones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl ketonesaryl-phenylketonesbenzoic acid estersbenzophenonesbenzoyl derivativescarboxylic acid estersdiphenylmethaneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsphenol estersphenoxy compounds |
|---|
| Substituents | diphenylmethanemonocyclic benzene moietyaryl-phenylketonebenzoylbenzoic acid or derivativesbenzoate estercarboxylic acid derivativebenzophenoneketonearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenol esterhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compounddepside backbonearyl ketone |
|---|
