| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:04 UTC |
|---|
| Update Date | 2025-03-25 00:50:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183217 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H3F12O8PS |
|---|
| Molecular Mass | 505.9095 |
|---|
| SMILES | O=C(OP(=O)(O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
|---|
| InChI Key | IRWJAVFBXIYTIW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | acyl monophosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalpha-halocarboxylic acid derivativescarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganofluoridesorganosulfonic acidssulfonyls |
|---|
| Substituents | alpha-halocarboxylic acid or derivativesaliphatic acyclic compoundorganosulfonic acid or derivativescarbonyl groupalkyl fluorideorganofluorideacyl monophosphateorganosulfonic acidorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundalpha-halocarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativesalkyl halidehydrocarbon derivativeorganooxygen compound |
|---|