| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:04 UTC |
|---|
| Update Date | 2025-03-25 00:50:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183219 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C2H7O11P3 |
|---|
| Molecular Mass | 299.9201 |
|---|
| SMILES | O=C(OP(=O)(O)O)C(P(=O)(O)O)P(=O)(O)O |
|---|
| InChI Key | VZHGZFGYQQJYRI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphonic acids and derivatives |
|---|
| Subclass | bisphosphonates |
|---|
| Direct Parent | bisphosphonates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyl monophosphatescarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundbisphosphonatecarbonyl groupacyl monophosphatecarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganic phosphoric acid derivativeorganooxygen compoundacyl phosphate |
|---|
