Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:52:05 UTC |
---|
Update Date | 2025-03-25 00:50:49 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02183250 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C13H14O10 |
---|
Molecular Mass | 330.0587 |
---|
SMILES | O=C(OC1C(C(=O)O)OC(O)C(O)C1O)c1cc(O)cc(O)c1 |
---|
InChI Key | FOSVGIAJCNOXGW-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | glucuronic acid derivatives |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzoyl derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidsresorcinolssecondary alcoholsm-hydroxybenzoic acid esters |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidglucuronic acid or derivativesaromatic heteromonocyclic compoundbenzoyl1-hydroxy-2-unsubstituted benzenoidmonosaccharidebenzoate estercarboxylic acid derivativepyran carboxylic acidresorcinolorganic oxidehemiacetaloxanem-hydroxybenzoic acid esterorganoheterocyclic compound1,2-diolalcoholpyran carboxylic acid or derivativesbenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidoxacyclepyrancarboxylic acid estersecondary alcoholdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoid |
---|