| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:06 UTC |
|---|
| Update Date | 2025-03-25 00:50:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183284 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H16O6 |
|---|
| Molecular Mass | 316.0947 |
|---|
| SMILES | O=C1CC(CO)(Cc2ccc(O)cc2)Oc2cc(O)cc(O)c21 |
|---|
| InChI Key | IGQVRUVJQHZNGN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzopyrans |
|---|
| Subclass | 1-benzopyrans |
|---|
| Direct Parent | chromones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalcohols and polyolsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesoxacyclic compoundsvinylogous acids |
|---|
| Substituents | alcoholmonocyclic benzene moietyetheraryl alkyl ketone1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidalkyl aryl etherketoneoxacyclevinylogous acidorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
