| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:08 UTC |
|---|
| Update Date | 2025-03-25 00:50:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183335 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H10O5 |
|---|
| Molecular Mass | 282.0528 |
|---|
| SMILES | O=C(c1ccccc1)c1coc2cc(O)cc(O)c2c1=O |
|---|
| InChI Key | VMPJDWDVECLZAK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | homoisoflavonoids |
|---|
| Subclass | homoisoflavones |
|---|
| Direct Parent | homoisoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaryl ketonesaryl-phenylketonesbenzoyl derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | monocyclic benzene moietyhomoisoflavone1-benzopyranbenzoyl1-hydroxy-2-unsubstituted benzenoidketoneorganic oxidechromonearomatic heteropolycyclic compoundisoflavonoidpyranoneorganoheterocyclic compoundbenzopyranaryl-phenylketoneheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundpyranhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|