Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-21 14:52:08 UTC |
---|
Update Date | 2025-03-25 00:50:51 UTC |
---|
HMDB ID | HMDB0137513 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02183342 |
---|
Name | 5,6-dihydroxy-2-[(4-hydroxyphenyl)methylidene]-2,3-dihydro-1-benzofuran-3-one |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C15H10O5 |
---|
Molecular Mass | 270.0528 |
---|
SMILES | O=C1C(=Cc2ccc(O)cc2)Oc2cc(O)c(O)cc21 |
---|
InChI Key | BCTHJXUYNPAYJK-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | aurone flavonoids |
---|
Subclass | aurone flavonoids |
---|
Direct Parent | aurone flavonoids |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl ketonesbenzene and substituted derivativesbenzofuranonescoumaranshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compounds |
---|
Substituents | monocyclic benzene moietyauronebenzofuranonebenzofuran1-hydroxy-2-unsubstituted benzenoidketoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundcoumaranorganooxygen compoundaryl ketone |
---|