| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 14:52:08 UTC |
|---|
| Update Date | 2025-03-25 00:50:51 UTC |
|---|
| HMDB ID | HMDB0137513 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183342 |
|---|
| Name | 5,6-dihydroxy-2-[(4-hydroxyphenyl)methylidene]-2,3-dihydro-1-benzofuran-3-one |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O5 |
|---|
| Molecular Mass | 270.0528 |
|---|
| SMILES | O=C1C(=Cc2ccc(O)cc2)Oc2cc(O)c(O)cc21 |
|---|
| InChI Key | BCTHJXUYNPAYJK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | aurone flavonoids |
|---|
| Subclass | aurone flavonoids |
|---|
| Direct Parent | aurone flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl ketonesbenzene and substituted derivativesbenzofuranonescoumaranshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietyauronebenzofuranonebenzofuran1-hydroxy-2-unsubstituted benzenoidketoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundcoumaranorganooxygen compoundaryl ketone |
|---|