| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:09 UTC |
|---|
| Update Date | 2025-03-25 00:50:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183382 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H10O6 |
|---|
| Molecular Mass | 298.0477 |
|---|
| SMILES | O=C(O)c1c(-c2ccc(O)cc2)oc2ccc(O)cc2c1=O |
|---|
| InChI Key | VNFZQQLARSZLQD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 6-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids4'-hydroxyflavonoidsbenzene and substituted derivativescarboxylic acidschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | monocyclic benzene moietybenzopyrancarboxylic acid1-benzopyran6-hydroxyflavonoidheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyranpyranone4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
