| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:11 UTC |
|---|
| Update Date | 2025-03-25 00:50:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183471 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O4 |
|---|
| Molecular Mass | 254.0579 |
|---|
| SMILES | O=C(O)c1ccc2c(c1)C(O)c1ccccc1C2=O |
|---|
| InChI Key | DXQXBNCSXJYPIO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | anthracenes |
|---|
| Subclass | anthracenecarboxylic acids and derivatives |
|---|
| Direct Parent | anthracenecarboxylic acids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | aryl ketonescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthalenecarboxylic acidsorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholcarboxylic acidaromatic homopolycyclic compoundcarboxylic acid derivativeanthracene carboxylic acidketoneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound2-naphthalenecarboxylic acid or derivativessecondary alcoholhydrocarbon derivative2-naphthalenecarboxylic acidorganooxygen compoundaryl ketone |
|---|