| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:14 UTC |
|---|
| Update Date | 2025-03-25 00:50:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183568 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H8O4 |
|---|
| Molecular Mass | 228.0423 |
|---|
| SMILES | O=C(O)c1cc2c(cc1O)oc1ccccc12 |
|---|
| InChI Key | PBTGPULVUFUPNO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzofurans |
|---|
| Subclass | dibenzofurans |
|---|
| Direct Parent | dibenzofurans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoidsbenzenoidsfuransheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundssalicylic acid and derivativesvinylogous acids |
|---|
| Substituents | furancarboxylic aciddibenzofuranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativehydroxybenzoic acidoxacyclevinylogous acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativesaromatic heteropolycyclic compoundhydrocarbon derivativebenzenoid1-carboxy-2-haloaromatic compoundorganooxygen compound |
|---|
