| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:15 UTC |
|---|
| Update Date | 2025-03-25 00:50:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183596 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15N3OS |
|---|
| Molecular Mass | 249.0936 |
|---|
| SMILES | O=C1NC2CSC(CCc3ccccn3)C2N1 |
|---|
| InChI Key | GDSWLSIXGIXLLL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | thienoimidazolidines |
|---|
| Subclass | thienoimidazolidines |
|---|
| Direct Parent | thienoimidazolidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesazacyclic compoundscarbonyl compoundsdialkylthioethersheteroaromatic compoundshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyridines and derivativesthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidinecarbonyl groupcarbonic acid derivativeazacycledialkylthioetherheteroaromatic compoundthienoimidazolidinethiopheneimidazolidinoneorganic oxidepyridineorganic oxygen compoundaromatic heteropolycyclic compoundthioetherorganonitrogen compoundorganopnictogen compoundhydrocarbon derivative2-halopyridineorganic nitrogen compoundorganooxygen compound |
|---|
