| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:15 UTC |
|---|
| Update Date | 2025-03-25 00:50:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183630 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H11NO6 |
|---|
| Molecular Mass | 253.0586 |
|---|
| SMILES | O=C1NC(=O)C(Cc2ccc(O)c(O)c2)OC1O |
|---|
| InChI Key | VTFRZQWKWKPHDD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-4-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdicarboximideshemiacetalshydrocarbon derivativesmorpholinesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativecarboxylic acid imide, n-unsubstitutedorganic oxideorganonitrogen compoundorganopnictogen compoundhemiacetaldicarboximideorganoheterocyclic compoundazacycle1-hydroxy-4-unsubstituted benzenoidoxazinanecarboxylic acid imideoxacyclemorpholineorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
