| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:16 UTC |
|---|
| Update Date | 2025-03-25 00:50:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183637 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H7N3O4 |
|---|
| Molecular Mass | 233.0437 |
|---|
| SMILES | O=C1N=C(Nc2ccc(O)cc2)NC(=O)C1=O |
|---|
| InChI Key | LKRRKCDTMFSRIP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativescarboximidamidescarboxylic acids and derivativescyclic ketonesguanidineshydrocarbon derivativeshydropyrimidinesn-acyliminesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | n-acyliminemonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundguanidine1-hydroxy-2-unsubstituted benzenoidpyrimidonecyclic ketonecarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundketoneorganic oxideorganonitrogen compoundhydropyrimidineorganopnictogen compound1,4,5,6-tetrahydropyrimidineazacycleorganic 1,3-dipolar compoundcarboximidamideorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|