| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:17 UTC |
|---|
| Update Date | 2025-03-25 00:50:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183673 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H14Cl2O2 |
|---|
| Molecular Mass | 332.0371 |
|---|
| SMILES | O=C1OCC2Cc3ccccc3C(c3ccc(Cl)c(Cl)c3)C12 |
|---|
| InChI Key | RVIDLCIPCJEBFS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | lignan lactones |
|---|
| Subclass | lignan lactones |
|---|
| Direct Parent | lignan lactones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl chloridesaryltetralin lignanscarbonyl compoundscarboxylic acid estersdichlorobenzenesgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthofuransorganic oxidesorganochloridesoxacyclic compoundstetrahydrofuranstetralins |
|---|
| Substituents | tetralinmonocyclic benzene moietycarbonyl grouporganochloride1-aryltetralin lignancarboxylic acid derivativeorganohalogen compoundlignan lactonelactoneorganic oxidearomatic heteropolycyclic compound1,2-dichlorobenzeneorganoheterocyclic compoundaryl chloridechlorobenzenenaphthofurantetrahydrofurangamma butyrolactonearyl halideoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativebenzenoidhalobenzeneorganooxygen compound |
|---|