Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:52:17 UTC |
---|
Update Date | 2025-03-25 00:50:54 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02183686 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C5H6O8S |
---|
Molecular Mass | 225.9783 |
---|
SMILES | O=C1OCC(O)=C(OS(=O)(=O)O)C1O |
---|
InChI Key | GLWDGMNEFLUJJW-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | pyrans |
---|
Subclass | pyranones and derivatives |
---|
Direct Parent | dihydropyranones |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | carbonyl compoundscarboxylic acid estershydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundssecondary alcoholssulfuric acid monoesters |
---|
Substituents | alcoholsulfuric acid monoestercarbonyl grouporganic sulfuric acid or derivativesdihydropyranonecarboxylic acid derivativelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid esterorganooxygen compound |
---|