| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:17 UTC |
|---|
| Update Date | 2025-03-25 00:50:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183708 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O4 |
|---|
| Molecular Mass | 256.0736 |
|---|
| SMILES | O=C1Oc2c(O)cccc2CC1c1ccc(O)cc1 |
|---|
| InChI Key | RYDUTKIXJDCLDT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | 3-arylcoumarin flavonoids |
|---|
| Direct Parent | 3-arylcoumarin flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3,4-dihydrocoumarinsbenzene and substituted derivativescarbonyl compoundscarboxylic acid estershydrocarbon derivativesisoflavanslactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietycarbonyl group1-benzopyran1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativelactoneorganic oxidearomatic heteropolycyclic compoundchromaneorganoheterocyclic compoundisoflavanbenzopyran3,4-dihydrocoumarin1-hydroxy-4-unsubstituted benzenoidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativebenzenoid3-arylcoumarin flavonoidorganooxygen compound |
|---|