| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:18 UTC |
|---|
| Update Date | 2025-03-25 00:50:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183719 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O5 |
|---|
| Molecular Mass | 272.0685 |
|---|
| SMILES | O=C1OC(Cc2ccc(O)cc2)c2cc(O)cc(O)c21 |
|---|
| InChI Key | URZQEIMSCMFMOA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzofurans |
|---|
| Subclass | benzofuranones |
|---|
| Direct Parent | benzofuranones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescarboxylic acid estershydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundsphthalidesvinylogous acids |
|---|
| Substituents | monocyclic benzene moietybenzofuranone1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativephthalidelactoneoxacyclevinylogous acidorganic oxidemonocarboxylic acid or derivativesisobenzofuranoneisocoumaranorganic oxygen compoundaromatic heteropolycyclic compoundcarboxylic acid esterphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
