Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:52:20 UTC |
---|
Update Date | 2025-03-25 00:50:55 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02183801 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C17H20O13S |
---|
Molecular Mass | 464.0625 |
---|
SMILES | O=C1CCC(Cc2cc(OC3C(C(=O)O)OC(O)C(O)C3O)cc(OS(=O)(=O)O)c2)O1 |
---|
InChI Key | ZGUSSXKPORKUKV-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | glucuronic acid derivatives |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1,2-diolsalkyl aryl etherscarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesgamma butyrolactoneshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundsphenylsulfatespyran carboxylic acidssecondary alcoholssulfuric acid monoesterstetrahydrofurans |
---|
Substituents | phenol ethermonocyclic benzene moietysulfuric acid monoestercarbonyl groupethercarboxylic acidglucuronic acid or derivativesaromatic heteromonocyclic compoundmonosaccharidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acidlactonephenylsulfateorganic oxidehemiacetalarylsulfateoxaneorganoheterocyclic compound1,2-diolalcoholpyran carboxylic acid or derivativesorganic sulfuric acid or derivativestetrahydrofurangamma butyrolactoneoxacyclepyrancarboxylic acid estersecondary alcoholdicarboxylic acid or derivativessulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid ester |
---|