| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:21 UTC |
|---|
| Update Date | 2025-03-25 00:50:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183825 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C32H34O19 |
|---|
| Molecular Mass | 722.1694 |
|---|
| SMILES | O=C1CC(c2ccc(O)c(O)c2)Oc2oc(-c3ccc(O)c(O)c3)c(OC3OC(COC4OC(CO)C(O)C(O)C4O)C(O)C(O)C3O)c(=O)c21 |
|---|
| InChI Key | FQFSJAVMOUVTRG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | diarylheptanoids |
|---|
| Subclass | linear diarylheptanoids |
|---|
| Direct Parent | linear diarylheptanoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholspyranones and derivativessecondary alcoholsvinylogous esters |
|---|
| Substituents | monocyclic benzene moietyetheraryl alkyl ketone1-hydroxy-2-unsubstituted benzenoidmonosaccharidealkyl aryl etherketonesaccharideorganic oxideacetalaromatic heteropolycyclic compoundpyranoneoxaneprimary alcoholorganoheterocyclic compoundalcoholvinylogous esterheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidoxacycleorganic oxygen compoundpyransecondary alcoholphenollinear 1,7-diphenylheptane skeletonhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|