| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:22 UTC |
|---|
| Update Date | 2025-03-25 00:50:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183848 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7NO6S |
|---|
| Molecular Mass | 220.9994 |
|---|
| SMILES | O=C1CC=C(COS(=O)(=O)O)C(=O)N1 |
|---|
| InChI Key | LUWZCODLMNWFFW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupazacyclecarboxylic acid derivativecarboxylic acid imidecarboxylic acid imide, n-unsubstitutedorganic oxideorganic oxygen compoundalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundsulfate-esterhydrocarbon derivativedicarboximideorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
