| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:23 UTC |
|---|
| Update Date | 2025-03-25 00:50:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183908 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O6 |
|---|
| Molecular Mass | 286.0477 |
|---|
| SMILES | O=C1CCc2c(cc(O)c3c4c(c(=O)oc23)C(=O)CC4)O1 |
|---|
| InChI Key | MJIQAUMQNDOBJU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | pyranocoumarins |
|---|
| Direct Parent | angular pyranocoumarins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids3,4-dihydrocoumarinsaryl alkyl ketonesbenzenoidscarboxylic acid estersheteroaromatic compoundshydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundspyranochromenespyranones and derivatives |
|---|
| Substituents | carbonyl grouparyl alkyl ketone1-benzopyran1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeangular pyranocoumarinketonelactoneorganic oxidearomatic heteropolycyclic compoundpyranonechromaneorganoheterocyclic compoundbenzopyranpyranochromeneheteroaromatic compound3,4-dihydrocoumarinoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyrancarboxylic acid esterhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
