| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:23 UTC |
|---|
| Update Date | 2025-03-25 00:50:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183909 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H12O4 |
|---|
| Molecular Mass | 280.0736 |
|---|
| SMILES | O=C1CCc2c1c(=O)oc1c3c(cc(O)c21)C=CC1CC31 |
|---|
| InChI Key | BYGHPBSJVBDBEI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | naphthopyrans |
|---|
| Subclass | naphthopyrans |
|---|
| Direct Parent | naphthopyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoidsaryl alkyl ketonescoumarins and derivativesheteroaromatic compoundshydrocarbon derivativeslactonesnaphthols and derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | benzopyranaryl alkyl ketone1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidcoumarinketonelactoneoxacyclenaphthopyranorganic oxidenaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundpyranpyranonehydrocarbon derivativebenzenoid2-naphtholorganooxygen compoundaryl ketone |
|---|