| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:24 UTC |
|---|
| Update Date | 2025-03-25 00:50:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02183923 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H24O6S |
|---|
| Molecular Mass | 344.1294 |
|---|
| SMILES | OC(CCSCC1OC(O)C(O)C(O)C1O)Cc1ccccc1 |
|---|
| InChI Key | LQBIGIRTJWLLQR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativesdialkylthioethershemiacetalshydrocarbon derivativesoxacyclic compoundsoxanessecondary alcoholssulfenyl compounds |
|---|
| Substituents | alcoholmonocyclic benzene moietysulfenyl compoundaromatic heteromonocyclic compounddialkylthioethermonosaccharideorganosulfur compoundoxacyclethioethersecondary alcoholhemiacetalhydrocarbon derivativebenzenoidoxaneorganoheterocyclic compound |
|---|
