Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:52:25 UTC |
---|
Update Date | 2025-03-25 00:50:58 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02183985 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C14H19NO4 |
---|
Molecular Mass | 265.1314 |
---|
SMILES | NC(CCCCC(=O)OCc1ccccc1)C(=O)O |
---|
InChI Key | XLXODYKTCQQEEM-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzyloxycarbonyls |
---|
Direct Parent | benzyloxycarbonyls |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesfatty acid estershydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
---|
Substituents | benzyloxycarbonylfatty acylcarbonyl groupcarboxylic acidalpha-amino acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundfatty acid esterorganic oxideorganic oxygen compoundcarboxylic acid esterorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|