Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:52:31 UTC |
---|
Update Date | 2025-03-25 00:51:00 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02184208 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C4H7NO8S |
---|
Molecular Mass | 228.9892 |
---|
SMILES | NC(C(=O)O)C(=O)OCOS(=O)(=O)O |
---|
InChI Key | PCHSQBHOKJKPOK-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | alpha amino acid esters |
---|
Geometric Descriptor | aliphatic acyclic compounds |
---|
Alternative Parents | 1,3-dicarbonyl compoundsalkyl sulfatesalpha amino acidscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfuric acid monoesters |
---|
Substituents | aliphatic acyclic compoundsulfuric acid monoestercarbonyl groupcarboxylic acidorganic sulfuric acid or derivativesalpha-amino acid esterorganic oxideorganic oxygen compoundcarboxylic acid esteralkyl sulfateorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundsulfate-esterhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compound1,3-dicarbonyl compoundsulfuric acid esterorganooxygen compound |
---|