DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-21 14:52:33 UTC
Update Date	2025-03-25 00:51:01 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID02184263
Frequency	0.5
Structure
Chemical Formula	C₂₀H₂₀I₂N₂O₇
Molecular Mass	653.936
SMILES	NC(CCC(=O)NC(Cc1ccc(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)O)C(=O)O
InChI Key	OTOOAZNITRWQKH-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	carboxylic acids and derivatives
Subclass	amino acids, peptides, and analogues
Direct Parent	dipeptides
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	1-hydroxy-2-unsubstituted benzenoids alpha amino acids amphetamines and derivatives aryl iodides carbonyl compounds carboxylic acids diarylethers dicarboxylic acids and derivatives diphenylethers glutamine and derivatives halophenols hydrocarbon derivatives iodobenzenes monoalkylamines n-acyl amines n-acyl-alpha amino acids o-iodophenols organic oxides organoiodides organonitrogen compounds organopnictogen compounds phenol ethers phenoxy compounds phenylalanine and derivatives phenylpropanoic acids secondary carboxylic acid amides
Substituents	diaryl ether fatty acyl phenol ether monocyclic benzene moiety carbonyl group ether carboxylic acid glutamine or derivatives 3-phenylpropanoic-acid fatty amide 1-hydroxy-2-unsubstituted benzenoid alpha-amino acid or derivatives organohalogen compound iodobenzene organoiodide organic oxide organonitrogen compound alpha-amino acid organopnictogen compound amphetamine or derivatives n-acyl-alpha amino acid or derivatives n-acyl-alpha-amino acid 2-iodophenol carboxamide group n-acyl-amine aryl halide aromatic homomonocyclic compound alpha-dipeptide 2-halophenol secondary carboxylic acid amide phenylalanine or derivatives organic oxygen compound dicarboxylic acid or derivatives phenol hydrocarbon derivative benzenoid primary aliphatic amine aryl iodide organic nitrogen compound halobenzene phenoxy compound diphenylether organooxygen compound

Showing information for DMID02184263