Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:52:35 UTC |
---|
Update Date | 2025-03-25 00:51:02 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02184350 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C18H24N2O11 |
---|
Molecular Mass | 444.138 |
---|
SMILES | NC(Cc1ccc(O)cc1)C(=O)NCC(OC1OC(C(=O)O)C(O)C(O)C1O)C(=O)O |
---|
InChI Key | HJCHAXQTGOHUDS-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | peptidomimetics |
---|
Subclass | hybrid peptides |
---|
Direct Parent | hybrid glycopeptides |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsalpha amino acid amidesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativesbeta amino acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesfatty amidesglucuronic acid derivativeshydrocarbon derivativesmonoalkylaminesmonosaccharideso-glucuronidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenylalanine and derivativespyran carboxylic acidssecondary alcoholssecondary carboxylic acid amidestyrosine and derivatives |
---|
Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidglucuronic acid or derivativesaromatic heteromonocyclic compoundfatty amideo-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidealpha-amino acid or derivativescarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetalorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxaneorganoheterocyclic compoundamphetamine or derivativesalcoholpyran carboxylic acid or derivativestyrosine or derivativesalpha-amino acid amidehydroxy acidcarboxamide groupbeta amino acid or derivativesoxacyclesecondary carboxylic acid amidephenylalanine or derivativesorganic oxygen compoundpyranhybrid glycopeptidesecondary alcoholdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|