Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:52:35 UTC |
---|
Update Date | 2025-03-25 00:51:02 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02184352 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C13H16N2O6 |
---|
Molecular Mass | 296.1008 |
---|
SMILES | NC(Cc1ccc(O)cc1)C(=O)NC(C(=O)O)C(O)C=O |
---|
InChI Key | YVLPFVARCLTNTA-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | dipeptides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsalpha-hydroxyaldehydesamphetamines and derivativesbenzene and substituted derivativesbeta hydroxy acids and derivativescarboxylic acidsfatty amideshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesmonosaccharidesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylalanine and derivativessecondary alcoholssecondary carboxylic acid amidestyrosine and derivatives |
---|
Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidfatty amide1-hydroxy-2-unsubstituted benzenoidmonosaccharidealpha-amino acid or derivativesbeta-hydroxy acidsaccharideorganic oxidealpha-hydroxyaldehydeorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativesalcoholtyrosine or derivativesalpha-amino acid amiden-acyl-alpha-amino acidaldehydehydroxy acidcarboxamide grouparomatic homomonocyclic compoundalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|