| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:40 UTC |
|---|
| Update Date | 2025-03-25 00:51:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02184531 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N3O4S |
|---|
| Molecular Mass | 259.0627 |
|---|
| SMILES | NC(CCSCC1=NCC(=O)NC1=O)C(=O)O |
|---|
| InChI Key | GEVQWGDAKCEASU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidsdialkylthioethersdicarboximidesheterocyclic fatty acidshydrocarbon derivativesketiminesmonoalkylaminesmonocarboxylic acids and derivativesn-unsubstituted carboxylic acid imidesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundssulfenyl compoundsthia fatty acids |
|---|
| Substituents | fatty acylketiminecarbonyl groupcarboxylic acidheterocyclic fatty acidiminefatty acidorganosulfur compoundpropargyl-type 1,3-dipolar organic compoundcarboxylic acid imide, n-unsubstitutedorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximideorganoheterocyclic compoundsulfenyl compoundazacycledialkylthioetherorganic 1,3-dipolar compoundcarboxylic acid imidemonocarboxylic acid or derivativesthia fatty acidorganic oxygen compoundthioetherhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
