| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:42 UTC |
|---|
| Update Date | 2025-03-25 00:51:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02184618 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H20NO12PS |
|---|
| Molecular Mass | 421.0444 |
|---|
| SMILES | NC(CSC1C(O)C(O)C(COP(=O)(O)O)OC1(O)CC(=O)O)C(=O)O |
|---|
| InChI Key | OHYRGRGYIUWZNX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | saccharolipids |
|---|
| Subclass | saccharolipids |
|---|
| Direct Parent | saccharolipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha amino acidscarbonyl compoundscarboxylic acidscysteine and derivativesdialkylthioethersdicarboxylic acids and derivativesfatty acylshemiacetalshexose phosphateshydrocarbon derivativeshydroxy fatty acidsmonoalkyl phosphatesmonoalkylaminesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssulfenyl compoundsthia fatty acids |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidmonosaccharidealpha-amino acid or derivativesorganosulfur compoundcarboxylic acid derivativesaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhemiacetalhydroxy fatty acidoxaneorganoheterocyclic compound1,2-diolalcoholsulfenyl compounddialkylthioetheroxacyclethia fatty acidorganic oxygen compoundphosphoric acid esterthioethermonoalkyl phosphatecysteine or derivativessecondary alcoholhexose phosphatedicarboxylic acid or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundsaccharolipidorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
