| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:42 UTC |
|---|
| Update Date | 2025-03-25 00:51:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02184625 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H15ClN2O5S |
|---|
| Molecular Mass | 358.039 |
|---|
| SMILES | NC(CS(=O)(=O)c1ccc(NCc2ccco2)cc1Cl)C(=O)O |
|---|
| InChI Key | CIPNYPMMJFTSLJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acidsaryl chloridesbenzenesulfonyl compoundscarbonyl compoundscarboxylic acidschlorobenzenesfuransheteroaromatic compoundshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganochloridesorganopnictogen compoundsoxacyclic compoundsphenylalkylaminessecondary alkylarylaminessulfones |
|---|
| Substituents | furanmonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acidorganochlorideorganosulfur compoundorganohalogen compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundbenzenesulfonyl grouparyl chloridechlorobenzeneheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic aminearyl halideoxacyclemonocarboxylic acid or derivativessulfonylorganic oxygen compoundphenylalkylaminehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundhalobenzeneamineorganooxygen compoundsulfone |
|---|