Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:52:44 UTC |
---|
Update Date | 2025-03-25 00:51:05 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02184691 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C17H17NO4 |
---|
Molecular Mass | 299.1158 |
---|
SMILES | NC(COC(=O)c1ccccc1Cc1ccccc1)C(=O)O |
---|
InChI Key | MYOFCMIAIMVMTI-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | diphenylmethanes |
---|
Direct Parent | diphenylmethanes |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acidsbenzoic acid estersbenzoyl derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
---|
Substituents | diphenylmethanecarbonyl groupcarboxylic acidbenzoylbenzoic acid or derivativesbenzoate esteralpha-amino acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid esterorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|