| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:45 UTC |
|---|
| Update Date | 2025-03-25 00:51:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02184723 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C29H35Cl2N11O |
|---|
| Molecular Mass | 623.2403 |
|---|
| SMILES | N=C(NCCCCCCNC(=N)NC(=N)Nc1ccc(C(=O)Nc2ccc(Cl)cc2)cc1)NC(=N)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | JUEINDRJCCXBKZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | benzanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-arylbiguanidesaryl chloridesbenzamidesbenzoyl derivativescarboximidamidescarboxylic acids and derivativeschlorobenzenesguanidinobenzoic acids and derivativeshydrocarbon derivativesiminesorganic oxidesorganochloridesorganooxygen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | benzanilideguanidineimineorganochloridebenzoylcarboxylic acid derivativeorganohalogen compoundbenzamideorganic oxideorganonitrogen compoundorganopnictogen compound1-arylbiguanidearyl chloridechlorobenzenebenzoic acid or derivativescarboximidamidecarboxamide grouparyl halidearomatic homomonocyclic compoundsecondary carboxylic acid amidearylbiguanideorganic oxygen compoundhydrocarbon derivativeguanidinobenzoic acid or derivativesorganic nitrogen compoundbiguanidehalobenzeneorganooxygen compound |
|---|