| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:52:45 UTC |
|---|
| Update Date | 2025-03-25 00:51:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02184739 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H17N3O5S |
|---|
| Molecular Mass | 279.0889 |
|---|
| SMILES | N=C(NCCCC(O)C(=O)O)SCC(N)C(=O)O |
|---|
| InChI Key | SOEHKCWSWWUGRK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | delta amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsalpha hydroxy acids and derivativescarbonyl compoundscarboximidamidescarboxylic acidscysteine and derivativesdicarboxylic acids and derivativeshydrocarbon derivativeshydroxy fatty acidsiminesisothioureasmonoalkylaminesmonosaccharidesorganic oxidesorganopnictogen compoundssecondary alcoholsshort-chain hydroxy acids and derivativessulfenyl compounds |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidiminealpha-hydroxy acidmonosaccharidefatty acidalpha-amino acid or derivativesorganosulfur compoundsaccharideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compounddelta amino acid or derivativeshydroxy fatty acidisothioureaalcoholsulfenyl compoundcarboximidamidehydroxy acidorganic oxygen compoundcysteine or derivativessecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|